C16H22F3NO — CID 102848912
2-(2-methoxyethyl)-N-[3-(trifluoromethyl)cyclohexyl]aniline (PubChem CID 102848912) has the molecular formula C16H22F3NO and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-N-[3-(trifluoromethyl)cyclohexyl]aniline.
| Compound Name | 2-(2-methoxyethyl)-N-[3-(trifluoromethyl)cyclohexyl]aniline |
|---|---|
| PubChem CID | 102848912 |
| Molecular Formula | C16H22F3NO |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 2-(2-methoxyethyl)-N-[3-(trifluoromethyl)cyclohexyl]aniline |
| SMILES | COCCc1ccccc1NC1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C16H22F3NO/c1-21-10-9-12-5-2-3-8-15(12)20-14-7-4-6-13(11-14)16(17,18)19/h2-3,5,8,13-14,20H,4,6-7,9-11H2,1H3 |
| InChIKey | ICKJSUROJNGIHJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |