C18H28N2 — CID 102849255
2-(2-phenylpropyl)-2,8-diazaspiro[5.5]undecane (PubChem CID 102849255) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 2-(2-phenylpropyl)-2,8-diazaspiro[5.5]undecane.
| Compound Name | 2-(2-phenylpropyl)-2,8-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 102849255 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 2-(2-phenylpropyl)-2,8-diazaspiro[5.5]undecane |
| SMILES | CC(CN1CCCC2(CCCNC2)C1)c1ccccc1 |
| InChI | InChI=1S/C18H28N2/c1-16(17-7-3-2-4-8-17)13-20-12-6-10-18(15-20)9-5-11-19-14-18/h2-4,7-8,16,19H,5-6,9-15H2,1H3 |
| InChIKey | FEPJVIHYQGQTTI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |