C11H19NO4 — CID 102849858
N-[2-(2-methylprop-2-enoxy)ethyl]-1,3-dioxane-2-carboxamide (PubChem CID 102849858) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is N-[2-(2-methylprop-2-enoxy)ethyl]-1,3-dioxane-2-carboxamide.
| Compound Name | N-[2-(2-methylprop-2-enoxy)ethyl]-1,3-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 102849858 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | N-[2-(2-methylprop-2-enoxy)ethyl]-1,3-dioxane-2-carboxamide |
| SMILES | C=C(C)COCCNC(=O)C1OCCCO1 |
| InChI | InChI=1S/C11H19NO4/c1-9(2)8-14-7-4-12-10(13)11-15-5-3-6-16-11/h11H,1,3-8H2,2H3,(H,12,13) |
| InChIKey | DRZYCWZXBGLVFQ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|