C17H25N3O — CID 102850523
2-(2,8-diazaspiro[5.5]undecan-2-yl)-4-methylbenzamide (PubChem CID 102850523) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 2-(2,8-diazaspiro[5.5]undecan-2-yl)-4-methylbenzamide.
| Compound Name | 2-(2,8-diazaspiro[5.5]undecan-2-yl)-4-methylbenzamide |
|---|---|
| PubChem CID | 102850523 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 2-(2,8-diazaspiro[5.5]undecan-2-yl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(N)=O)c(N2CCCC3(CCCNC3)C2)c1 |
| InChI | InChI=1S/C17H25N3O/c1-13-4-5-14(16(18)21)15(10-13)20-9-3-7-17(12-20)6-2-8-19-11-17/h4-5,10,19H,2-3,6-9,11-12H2,1H3,(H2,18,21) |
| InChIKey | UDDQSGQKSNOYAG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |