C18H18BrNO — CID 102850817
[4-(bromomethyl)phenyl]-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methanone (PubChem CID 102850817) has the molecular formula C18H18BrNO and a molecular weight of 344.25 g/mol. Its IUPAC name is [4-(bromomethyl)phenyl]-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methanone.
| Compound Name | [4-(bromomethyl)phenyl]-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methanone |
|---|---|
| PubChem CID | 102850817 |
| Molecular Formula | C18H18BrNO |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | [4-(bromomethyl)phenyl]-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methanone |
| SMILES | Cc1ccc2c(c1)CCCN2C(=O)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C18H18BrNO/c1-13-4-9-17-16(11-13)3-2-10-20(17)18(21)15-7-5-14(12-19)6-8-15/h4-9,11H,2-3,10,12H2,1H3 |
| InChIKey | QREJWLVQQUPDPF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|