C54H42S12 — CID 10285083
[2,3,4,5,6-pentakis(benzenecarbonothioylsulfanylmethyl)phenyl]methyl benzenecarbodithioate (PubChem CID 10285083) has the molecular formula C54H42S12 and a molecular weight of 1075.73 g/mol. Its IUPAC name is [2,3,4,5,6-pentakis(benzenecarbonothioylsulfanylmethyl)phenyl]methyl benzenecarbodithioate.
| Compound Name | [2,3,4,5,6-pentakis(benzenecarbonothioylsulfanylmethyl)phenyl]methyl benzenecarbodithioate |
|---|---|
| PubChem CID | 10285083 |
| Molecular Formula | C54H42S12 |
| Molecular Weight | 1075.73 g/mol |
| Exact Mass | 1073.99 |
| IUPAC Name | [2,3,4,5,6-pentakis(benzenecarbonothioylsulfanylmethyl)phenyl]methyl benzenecarbodithioate |
| SMILES | S=C(SCc1c(CSC(=S)c2ccccc2)c(CSC(=S)c2ccccc2)c(CSC(=S)c2ccccc2)c(CSC(=S)c2ccccc2)c1CSC(=S)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C54H42S12/c55-49(37-19-7-1-8-20-37)61-31-43-44(32-62-50(56)38-21-9-2-10-22-38)46(34-64-52(58)40-25-13-4-14-26-40)48(36-66-54(60)42-29-17-6-18-30-42)47(35-65-53(59)41-27-15-5-16-28-41)45(43)33-63-51(57)39-23-11-3-12-24-39/h1-30H,31-36H2 |
| InChIKey | XMWOUBDVYDUJHC-UHFFFAOYSA-N |
| XLogP | 17.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1075.73 |
| LogP ≤ 5 | 17.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thio_ester_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|