About N'-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-N-methylethane-1,2-diamine
N'-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-N-methylethane-1,2-diamine (PubChem CID 102852208) has the molecular formula C13H26N2O2
and a molecular weight of 242.36 g/mol. Its IUPAC name is N'-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-N-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-N-methylethane-1,2-diamine |
| PubChem CID | 102852208 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | N'-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-N-methylethane-1,2-diamine |
| SMILES | CNCCNCCC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C13H26N2O2/c1-14-8-9-15-7-4-12-2-5-13(6-3-12)16-10-11-17-13/h12,14-15H,2-11H2,1H3 |
| InChIKey | NBBVAYJVUGOLEI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-N-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-N-methylethane-1,2-diamine?
The IUPAC name of N'-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-N-methylethane-1,2-diamine (CID 102852208) is N'-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-N-methylethane-1,2-diamine.
What is the SMILES notation for N'-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-N-methylethane-1,2-diamine?
The canonical SMILES for N'-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-N-methylethane-1,2-diamine is CNCCNCCC1CCC2(CC1)OCCO2.
What is the InChIKey of N'-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-N-methylethane-1,2-diamine?
The InChIKey is NBBVAYJVUGOLEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O2/c1-14-8-9-15-7-4-12-2-5-13(6-3-12)16-10-11-17-13/h12,14-15H,2-11H2,1H3.
What are the key properties of N'-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-N-methylethane-1,2-diamine?
N'-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-N-methylethane-1,2-diamine has a molecular weight of 242.36 g/mol, XLogP of 1.12, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-N-methylethane-1,2-diamine is sourced from PubChem (CID 102852208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).