C14H11BrF2N2O2 — CID 102852353
2-amino-N-(5-bromo-2,4-difluorophenyl)-3-methoxybenzamide (PubChem CID 102852353) has the molecular formula C14H11BrF2N2O2 and a molecular weight of 357.15 g/mol. Its IUPAC name is 2-amino-N-(5-bromo-2,4-difluorophenyl)-3-methoxybenzamide.
| Compound Name | 2-amino-N-(5-bromo-2,4-difluorophenyl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 102852353 |
| Molecular Formula | C14H11BrF2N2O2 |
| Molecular Weight | 357.15 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | 2-amino-N-(5-bromo-2,4-difluorophenyl)-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2cc(Br)c(F)cc2F)c1N |
| InChI | InChI=1S/C14H11BrF2N2O2/c1-21-12-4-2-3-7(13(12)18)14(20)19-11-5-8(15)9(16)6-10(11)17/h2-6H,18H2,1H3,(H,19,20) |
| InChIKey | YONWCVXJUOQGOE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.15 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|