C12H11BrF2N4O — CID 102852362
4-amino-N-(5-bromo-2,4-difluorophenyl)-1-ethylpyrazole-3-carboxamide (PubChem CID 102852362) has the molecular formula C12H11BrF2N4O and a molecular weight of 345.15 g/mol. Its IUPAC name is 4-amino-N-(5-bromo-2,4-difluorophenyl)-1-ethylpyrazole-3-carboxamide.
| Compound Name | 4-amino-N-(5-bromo-2,4-difluorophenyl)-1-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 102852362 |
| Molecular Formula | C12H11BrF2N4O |
| Molecular Weight | 345.15 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 4-amino-N-(5-bromo-2,4-difluorophenyl)-1-ethylpyrazole-3-carboxamide |
| SMILES | CCn1cc(N)c(C(=O)Nc2cc(Br)c(F)cc2F)n1 |
| InChI | InChI=1S/C12H11BrF2N4O/c1-2-19-5-9(16)11(18-19)12(20)17-10-3-6(13)7(14)4-8(10)15/h3-5H,2,16H2,1H3,(H,17,20) |
| InChIKey | DNVQADJXPPQNJE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.15 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|