C14H11BrClF2NO — CID 102852974
5-bromo-N-[(3-chloro-4-methoxyphenyl)methyl]-2,4-difluoroaniline (PubChem CID 102852974) has the molecular formula C14H11BrClF2NO and a molecular weight of 362.60 g/mol. Its IUPAC name is 5-bromo-N-[(3-chloro-4-methoxyphenyl)methyl]-2,4-difluoroaniline.
| Compound Name | 5-bromo-N-[(3-chloro-4-methoxyphenyl)methyl]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 102852974 |
| Molecular Formula | C14H11BrClF2NO |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 360.97 |
| IUPAC Name | 5-bromo-N-[(3-chloro-4-methoxyphenyl)methyl]-2,4-difluoroaniline |
| SMILES | COc1ccc(CNc2cc(Br)c(F)cc2F)cc1Cl |
| InChI | InChI=1S/C14H11BrClF2NO/c1-20-14-3-2-8(4-10(14)16)7-19-13-5-9(15)11(17)6-12(13)18/h2-6,19H,7H2,1H3 |
| InChIKey | WUXHMSZHKSHFCR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|