C15H13Br2F2N — CID 102853099
5-bromo-N-[1-(4-bromophenyl)propyl]-2,4-difluoroaniline (PubChem CID 102853099) has the molecular formula C15H13Br2F2N and a molecular weight of 405.08 g/mol. Its IUPAC name is 5-bromo-N-[1-(4-bromophenyl)propyl]-2,4-difluoroaniline.
| Compound Name | 5-bromo-N-[1-(4-bromophenyl)propyl]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 102853099 |
| Molecular Formula | C15H13Br2F2N |
| Molecular Weight | 405.08 g/mol |
| Exact Mass | 402.94 |
| IUPAC Name | 5-bromo-N-[1-(4-bromophenyl)propyl]-2,4-difluoroaniline |
| SMILES | CCC(Nc1cc(Br)c(F)cc1F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H13Br2F2N/c1-2-14(9-3-5-10(16)6-4-9)20-15-7-11(17)12(18)8-13(15)19/h3-8,14,20H,2H2,1H3 |
| InChIKey | MRWOUHVHJQTYKM-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.08 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|