About 5-bromo-N-(2,2-dimethylcyclohexyl)-2,4-difluoroaniline
5-bromo-N-(2,2-dimethylcyclohexyl)-2,4-difluoroaniline (PubChem CID 102853156) has the molecular formula C14H18BrF2N
and a molecular weight of 318.21 g/mol. Its IUPAC name is 5-bromo-N-(2,2-dimethylcyclohexyl)-2,4-difluoroaniline.
Molecular Properties
| Compound Name | 5-bromo-N-(2,2-dimethylcyclohexyl)-2,4-difluoroaniline |
| PubChem CID | 102853156 |
| Molecular Formula | C14H18BrF2N |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 5-bromo-N-(2,2-dimethylcyclohexyl)-2,4-difluoroaniline |
| SMILES | CC1(C)CCCCC1Nc1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C14H18BrF2N/c1-14(2)6-4-3-5-13(14)18-12-7-9(15)10(16)8-11(12)17/h7-8,13,18H,3-6H2,1-2H3 |
| InChIKey | GCPZFCDSXMOMTN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-N-(2,2-dimethylcyclohexyl)-2,4-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(2,2-dimethylcyclohexyl)-2,4-difluoroaniline?
The IUPAC name of 5-bromo-N-(2,2-dimethylcyclohexyl)-2,4-difluoroaniline (CID 102853156) is 5-bromo-N-(2,2-dimethylcyclohexyl)-2,4-difluoroaniline.
What is the SMILES notation for 5-bromo-N-(2,2-dimethylcyclohexyl)-2,4-difluoroaniline?
The canonical SMILES for 5-bromo-N-(2,2-dimethylcyclohexyl)-2,4-difluoroaniline is CC1(C)CCCCC1Nc1cc(Br)c(F)cc1F.
What is the InChIKey of 5-bromo-N-(2,2-dimethylcyclohexyl)-2,4-difluoroaniline?
The InChIKey is GCPZFCDSXMOMTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18BrF2N/c1-14(2)6-4-3-5-13(14)18-12-7-9(15)10(16)8-11(12)17/h7-8,13,18H,3-6H2,1-2H3.
What are the key properties of 5-bromo-N-(2,2-dimethylcyclohexyl)-2,4-difluoroaniline?
5-bromo-N-(2,2-dimethylcyclohexyl)-2,4-difluoroaniline has a molecular weight of 318.21 g/mol, XLogP of 5.11, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(2,2-dimethylcyclohexyl)-2,4-difluoroaniline is sourced from PubChem (CID 102853156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).