C15H9BrF2N2O — CID 102854713
N-(5-bromo-2,4-difluorophenyl)-1H-indole-2-carboxamide (PubChem CID 102854713) has the molecular formula C15H9BrF2N2O and a molecular weight of 351.15 g/mol. Its IUPAC name is N-(5-bromo-2,4-difluorophenyl)-1H-indole-2-carboxamide.
| Compound Name | N-(5-bromo-2,4-difluorophenyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 102854713 |
| Molecular Formula | C15H9BrF2N2O |
| Molecular Weight | 351.15 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | N-(5-bromo-2,4-difluorophenyl)-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1cc(Br)c(F)cc1F)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C15H9BrF2N2O/c16-9-6-13(11(18)7-10(9)17)20-15(21)14-5-8-3-1-2-4-12(8)19-14/h1-7,19H,(H,20,21) |
| InChIKey | ANAOTLXXTHLYNH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.15 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|