C10H6BrF2N3O3S — CID 102855097
2-[[4-(5-bromo-2,4-difluorophenyl)-5-oxo-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 102855097) has the molecular formula C10H6BrF2N3O3S and a molecular weight of 366.14 g/mol. Its IUPAC name is 2-[[4-(5-bromo-2,4-difluorophenyl)-5-oxo-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[4-(5-bromo-2,4-difluorophenyl)-5-oxo-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 102855097 |
| Molecular Formula | C10H6BrF2N3O3S |
| Molecular Weight | 366.14 g/mol |
| Exact Mass | 364.93 |
| IUPAC Name | 2-[[4-(5-bromo-2,4-difluorophenyl)-5-oxo-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | O=C(O)CSc1n[nH]c(=O)n1-c1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C10H6BrF2N3O3S/c11-4-1-7(6(13)2-5(4)12)16-9(19)14-15-10(16)20-3-8(17)18/h1-2H,3H2,(H,14,19)(H,17,18) |
| InChIKey | VDZRCJVUAKILKE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.14 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|