C13H9BrF2N2O3 — CID 102855148
ethyl 1-(5-bromo-2,4-difluorophenyl)-4-oxopyridazine-3-carboxylate (PubChem CID 102855148) has the molecular formula C13H9BrF2N2O3 and a molecular weight of 359.13 g/mol. Its IUPAC name is ethyl 1-(5-bromo-2,4-difluorophenyl)-4-oxopyridazine-3-carboxylate.
| Compound Name | ethyl 1-(5-bromo-2,4-difluorophenyl)-4-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 102855148 |
| Molecular Formula | C13H9BrF2N2O3 |
| Molecular Weight | 359.13 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | ethyl 1-(5-bromo-2,4-difluorophenyl)-4-oxopyridazine-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2cc(Br)c(F)cc2F)ccc1=O |
| InChI | InChI=1S/C13H9BrF2N2O3/c1-2-21-13(20)12-11(19)3-4-18(17-12)10-5-7(14)8(15)6-9(10)16/h3-6H,2H2,1H3 |
| InChIKey | SDLCUXCDFAKSTO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.13 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|