C13H13BrF2N4 — CID 102855537
4-N-(5-bromo-2,4-difluorophenyl)-6-N,2,5-trimethylpyrimidine-4,6-diamine (PubChem CID 102855537) has the molecular formula C13H13BrF2N4 and a molecular weight of 343.18 g/mol. Its IUPAC name is 4-N-(5-bromo-2,4-difluorophenyl)-6-N,2,5-trimethylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(5-bromo-2,4-difluorophenyl)-6-N,2,5-trimethylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 102855537 |
| Molecular Formula | C13H13BrF2N4 |
| Molecular Weight | 343.18 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 4-N-(5-bromo-2,4-difluorophenyl)-6-N,2,5-trimethylpyrimidine-4,6-diamine |
| SMILES | CNc1nc(C)nc(Nc2cc(Br)c(F)cc2F)c1C |
| InChI | InChI=1S/C13H13BrF2N4/c1-6-12(17-3)18-7(2)19-13(6)20-11-4-8(14)9(15)5-10(11)16/h4-5H,1-3H3,(H2,17,18,19,20) |
| InChIKey | QTKIQQNRYANYKS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.18 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|