About methyl 4-methylbenzenesulfinate
methyl 4-methylbenzenesulfinate (PubChem CID 10285823) has the molecular formula C8H10O2S
and a molecular weight of 170.23 g/mol. Its IUPAC name is methyl 4-methylbenzenesulfinate.
Molecular Properties
| Compound Name | methyl 4-methylbenzenesulfinate |
| PubChem CID | 10285823 |
| Molecular Formula | C8H10O2S |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | methyl 4-methylbenzenesulfinate |
| SMILES | COS(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C8H10O2S/c1-7-3-5-8(6-4-7)11(9)10-2/h3-6H,1-2H3 |
| InChIKey | MGPLBSPZSIFUQX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 4-methylbenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-methylbenzenesulfinate?
The IUPAC name of methyl 4-methylbenzenesulfinate (CID 10285823) is methyl 4-methylbenzenesulfinate.
What is the SMILES notation for methyl 4-methylbenzenesulfinate?
The canonical SMILES for methyl 4-methylbenzenesulfinate is COS(=O)c1ccc(C)cc1.
What is the InChIKey of methyl 4-methylbenzenesulfinate?
The InChIKey is MGPLBSPZSIFUQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2S/c1-7-3-5-8(6-4-7)11(9)10-2/h3-6H,1-2H3.
What are the key properties of methyl 4-methylbenzenesulfinate?
methyl 4-methylbenzenesulfinate has a molecular weight of 170.23 g/mol, XLogP of 1.66, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methylbenzenesulfinate is sourced from PubChem (CID 10285823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).