C10H20N2O2 — CID 102858549
2-[cyclobutyl(3-hydroxypropyl)amino]propanamide (PubChem CID 102858549) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-[cyclobutyl(3-hydroxypropyl)amino]propanamide.
| Compound Name | 2-[cyclobutyl(3-hydroxypropyl)amino]propanamide |
|---|---|
| PubChem CID | 102858549 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 2-[cyclobutyl(3-hydroxypropyl)amino]propanamide |
| SMILES | CC(C(N)=O)N(CCCO)C1CCC1 |
| InChI | InChI=1S/C10H20N2O2/c1-8(10(11)14)12(6-3-7-13)9-4-2-5-9/h8-9,13H,2-7H2,1H3,(H2,11,14) |
| InChIKey | FVBGPHNYXIIPMX-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |