C13H25N — CID 10285861
3,3,5,5-tetramethyl-1-prop-2-enylcyclohexan-1-amine (PubChem CID 10285861) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-1-prop-2-enylcyclohexan-1-amine.
| Compound Name | 3,3,5,5-tetramethyl-1-prop-2-enylcyclohexan-1-amine |
|---|---|
| PubChem CID | 10285861 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 3,3,5,5-tetramethyl-1-prop-2-enylcyclohexan-1-amine |
| SMILES | C=CCC1(N)CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C13H25N/c1-6-7-13(14)9-11(2,3)8-12(4,5)10-13/h6H,1,7-10,14H2,2-5H3 |
| InChIKey | NQZFDMAHJOSVDZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|