About N-(3-bromopropyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]cyclobutanamine
N-(3-bromopropyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]cyclobutanamine (PubChem CID 102860112) has the molecular formula C14H26BrNO
and a molecular weight of 304.27 g/mol. Its IUPAC name is N-(3-bromopropyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]cyclobutanamine.
Molecular Properties
| Compound Name | N-(3-bromopropyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]cyclobutanamine |
| PubChem CID | 102860112 |
| Molecular Formula | C14H26BrNO |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-(3-bromopropyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]cyclobutanamine |
| SMILES | CC1(C)CCC(CN(CCCBr)C2CCC2)O1 |
| InChI | InChI=1S/C14H26BrNO/c1-14(2)8-7-13(17-14)11-16(10-4-9-15)12-5-3-6-12/h12-13H,3-11H2,1-2H3 |
| InChIKey | HJEFOVDIIBCPEM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(3-bromopropyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]cyclobutanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-bromopropyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]cyclobutanamine?
The IUPAC name of N-(3-bromopropyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]cyclobutanamine (CID 102860112) is N-(3-bromopropyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]cyclobutanamine.
What is the SMILES notation for N-(3-bromopropyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]cyclobutanamine?
The canonical SMILES for N-(3-bromopropyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]cyclobutanamine is CC1(C)CCC(CN(CCCBr)C2CCC2)O1.
What is the InChIKey of N-(3-bromopropyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]cyclobutanamine?
The InChIKey is HJEFOVDIIBCPEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26BrNO/c1-14(2)8-7-13(17-14)11-16(10-4-9-15)12-5-3-6-12/h12-13H,3-11H2,1-2H3.
What are the key properties of N-(3-bromopropyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]cyclobutanamine?
N-(3-bromopropyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]cyclobutanamine has a molecular weight of 304.27 g/mol, XLogP of 3.58, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-bromopropyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]cyclobutanamine is sourced from PubChem (CID 102860112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).