C16H26N2O2 — CID 102860726
2-[3-[2-(aminomethyl)phenoxy]propyl-cyclobutylamino]ethanol (PubChem CID 102860726) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-[3-[2-(aminomethyl)phenoxy]propyl-cyclobutylamino]ethanol.
| Compound Name | 2-[3-[2-(aminomethyl)phenoxy]propyl-cyclobutylamino]ethanol |
|---|---|
| PubChem CID | 102860726 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 2-[3-[2-(aminomethyl)phenoxy]propyl-cyclobutylamino]ethanol |
| SMILES | NCc1ccccc1OCCCN(CCO)C1CCC1 |
| InChI | InChI=1S/C16H26N2O2/c17-13-14-5-1-2-8-16(14)20-12-4-9-18(10-11-19)15-6-3-7-15/h1-2,5,8,15,19H,3-4,6-7,9-13,17H2 |
| InChIKey | ULTLZCHSRNMJCS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|