C16H24O4 — CID 10286146
(7E,15E)-1,4-dioxacyclooctadeca-7,15-diene-6,17-dione (PubChem CID 10286146) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is (7E,15E)-1,4-dioxacyclooctadeca-7,15-diene-6,17-dione.
| Compound Name | (7E,15E)-1,4-dioxacyclooctadeca-7,15-diene-6,17-dione |
|---|---|
| PubChem CID | 10286146 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (7E,15E)-1,4-dioxacyclooctadeca-7,15-diene-6,17-dione |
| SMILES | O=C1/C=C/CCCCCC/C=C/C(=O)COCCOC1 |
| InChI | InChI=1S/C16H24O4/c17-15-9-7-5-3-1-2-4-6-8-10-16(18)14-20-12-11-19-13-15/h7-10H,1-6,11-14H2/b9-7+,10-8+ |
| InChIKey | HCVRZTNVJSLNCF-FIFLTTCUSA-N |
| XLogP | 2.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |