C15H16N4S — CID 10286183
N'-(7-thiophen-2-yl-1,6-naphthyridin-5-yl)propane-1,3-diamine (PubChem CID 10286183) has the molecular formula C15H16N4S and a molecular weight of 284.39 g/mol. Its IUPAC name is N'-(7-thiophen-2-yl-1,6-naphthyridin-5-yl)propane-1,3-diamine.
| Compound Name | N'-(7-thiophen-2-yl-1,6-naphthyridin-5-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 10286183 |
| Molecular Formula | C15H16N4S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | N'-(7-thiophen-2-yl-1,6-naphthyridin-5-yl)propane-1,3-diamine |
| SMILES | NCCCNc1nc(-c2cccs2)cc2ncccc12 |
| InChI | InChI=1S/C15H16N4S/c16-6-3-8-18-15-11-4-1-7-17-12(11)10-13(19-15)14-5-2-9-20-14/h1-2,4-5,7,9-10H,3,6,8,16H2,(H,18,19) |
| InChIKey | KNJVMUQIMMIFRX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|