C19H21NO2 — CID 10286260
(4aS,8aS,10aR)-1,1,4a,8a-tetramethyl-2,6-dioxo-10,10a-dihydro-9H-phenanthrene-3-carbonitrile (PubChem CID 10286260) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is (4aS,8aS,10aR)-1,1,4a,8a-tetramethyl-2,6-dioxo-10,10a-dihydro-9H-phenanthrene-3-carbonitrile.
| Compound Name | (4aS,8aS,10aR)-1,1,4a,8a-tetramethyl-2,6-dioxo-10,10a-dihydro-9H-phenanthrene-3-carbonitrile |
|---|---|
| PubChem CID | 10286260 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | (4aS,8aS,10aR)-1,1,4a,8a-tetramethyl-2,6-dioxo-10,10a-dihydro-9H-phenanthrene-3-carbonitrile |
| SMILES | CC1(C)C(=O)C(C#N)=C[C@]2(C)C3=CC(=O)C=C[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C19H21NO2/c1-17(2)14-6-8-18(3)7-5-13(21)9-15(18)19(14,4)10-12(11-20)16(17)22/h5,7,9-10,14H,6,8H2,1-4H3/t14-,18+,19-/m0/s1 |
| InChIKey | INKQDOKSUGHEOZ-KYNGSXCRSA-N |
| XLogP | 3.53 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |