C14H22N2O2 — CID 102863464
2-(1-aminoethyl)-5-[cyclobutyl(2-hydroxyethyl)amino]phenol (PubChem CID 102863464) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-(1-aminoethyl)-5-[cyclobutyl(2-hydroxyethyl)amino]phenol.
| Compound Name | 2-(1-aminoethyl)-5-[cyclobutyl(2-hydroxyethyl)amino]phenol |
|---|---|
| PubChem CID | 102863464 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2-(1-aminoethyl)-5-[cyclobutyl(2-hydroxyethyl)amino]phenol |
| SMILES | CC(N)c1ccc(N(CCO)C2CCC2)cc1O |
| InChI | InChI=1S/C14H22N2O2/c1-10(15)13-6-5-12(9-14(13)18)16(7-8-17)11-3-2-4-11/h5-6,9-11,17-18H,2-4,7-8,15H2,1H3 |
| InChIKey | MMMOPLMUVWWPPQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|