C16H23N3O2 — CID 102863499
6-[cyclobutyl(2-hydroxyethyl)amino]-3-(ethylamino)-1,3-dihydroindol-2-one (PubChem CID 102863499) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 6-[cyclobutyl(2-hydroxyethyl)amino]-3-(ethylamino)-1,3-dihydroindol-2-one.
| Compound Name | 6-[cyclobutyl(2-hydroxyethyl)amino]-3-(ethylamino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 102863499 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 6-[cyclobutyl(2-hydroxyethyl)amino]-3-(ethylamino)-1,3-dihydroindol-2-one |
| SMILES | CCNC1C(=O)Nc2cc(N(CCO)C3CCC3)ccc21 |
| InChI | InChI=1S/C16H23N3O2/c1-2-17-15-13-7-6-12(10-14(13)18-16(15)21)19(8-9-20)11-4-3-5-11/h6-7,10-11,15,17,20H,2-5,8-9H2,1H3,(H,18,21) |
| InChIKey | HZWZRUAJDAVYNT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|