C16H17N3O2S — CID 10286449
2,3-dimethyl-9-thiophen-3-yl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridine-7,8-diol (PubChem CID 10286449) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is 2,3-dimethyl-9-thiophen-3-yl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridine-7,8-diol.
| Compound Name | 2,3-dimethyl-9-thiophen-3-yl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridine-7,8-diol |
|---|---|
| PubChem CID | 10286449 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 2,3-dimethyl-9-thiophen-3-yl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridine-7,8-diol |
| SMILES | Cc1nc2c3c(ccn2c1C)C(O)C(O)C(c1ccsc1)N3 |
| InChI | InChI=1S/C16H17N3O2S/c1-8-9(2)19-5-3-11-13(16(19)17-8)18-12(15(21)14(11)20)10-4-6-22-7-10/h3-7,12,14-15,18,20-21H,1-2H3 |
| InChIKey | VJJBEVBSOSTEAG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |