C10H13Cl2N3O — CID 102865921
2-[cyclobutyl-(3,6-dichloropyridazin-4-yl)amino]ethanol (PubChem CID 102865921) has the molecular formula C10H13Cl2N3O and a molecular weight of 262.14 g/mol. Its IUPAC name is 2-[cyclobutyl-(3,6-dichloropyridazin-4-yl)amino]ethanol.
| Compound Name | 2-[cyclobutyl-(3,6-dichloropyridazin-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 102865921 |
| Molecular Formula | C10H13Cl2N3O |
| Molecular Weight | 262.14 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 2-[cyclobutyl-(3,6-dichloropyridazin-4-yl)amino]ethanol |
| SMILES | OCCN(c1cc(Cl)nnc1Cl)C1CCC1 |
| InChI | InChI=1S/C10H13Cl2N3O/c11-9-6-8(10(12)14-13-9)15(4-5-16)7-2-1-3-7/h6-7,16H,1-5H2 |
| InChIKey | LVZAPWRTOFUKNV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.14 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |