C14H27N3O3 — CID 102865941
N-cyclobutyl-2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(3-hydroxypropyl)butanamide (PubChem CID 102865941) has the molecular formula C14H27N3O3 and a molecular weight of 285.39 g/mol. Its IUPAC name is N-cyclobutyl-2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(3-hydroxypropyl)butanamide.
| Compound Name | N-cyclobutyl-2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(3-hydroxypropyl)butanamide |
|---|---|
| PubChem CID | 102865941 |
| Molecular Formula | C14H27N3O3 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | N-cyclobutyl-2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(3-hydroxypropyl)butanamide |
| SMILES | CCC(CC)(C(=O)N(CCCO)C1CCC1)C(N)=NO |
| InChI | InChI=1S/C14H27N3O3/c1-3-14(4-2,12(15)16-20)13(19)17(9-6-10-18)11-7-5-8-11/h11,18,20H,3-10H2,1-2H3,(H2,15,16) |
| InChIKey | RBUXFWIOVGYYEE-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|