About N-cyclobutyl-2-(2,4-difluorophenyl)-N-(3-hydroxypropyl)acetamide
N-cyclobutyl-2-(2,4-difluorophenyl)-N-(3-hydroxypropyl)acetamide (PubChem CID 102866065) has the molecular formula C15H19F2NO2
and a molecular weight of 283.32 g/mol. Its IUPAC name is N-cyclobutyl-2-(2,4-difluorophenyl)-N-(3-hydroxypropyl)acetamide.
Molecular Properties
| Compound Name | N-cyclobutyl-2-(2,4-difluorophenyl)-N-(3-hydroxypropyl)acetamide |
| PubChem CID | 102866065 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-cyclobutyl-2-(2,4-difluorophenyl)-N-(3-hydroxypropyl)acetamide |
| SMILES | O=C(Cc1ccc(F)cc1F)N(CCCO)C1CCC1 |
| InChI | InChI=1S/C15H19F2NO2/c16-12-6-5-11(14(17)10-12)9-15(20)18(7-2-8-19)13-3-1-4-13/h5-6,10,13,19H,1-4,7-9H2 |
| InChIKey | UKOPLIUHFFKDLB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclobutyl-2-(2,4-difluorophenyl)-N-(3-hydroxypropyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclobutyl-2-(2,4-difluorophenyl)-N-(3-hydroxypropyl)acetamide?
The IUPAC name of N-cyclobutyl-2-(2,4-difluorophenyl)-N-(3-hydroxypropyl)acetamide (CID 102866065) is N-cyclobutyl-2-(2,4-difluorophenyl)-N-(3-hydroxypropyl)acetamide.
What is the SMILES notation for N-cyclobutyl-2-(2,4-difluorophenyl)-N-(3-hydroxypropyl)acetamide?
The canonical SMILES for N-cyclobutyl-2-(2,4-difluorophenyl)-N-(3-hydroxypropyl)acetamide is O=C(Cc1ccc(F)cc1F)N(CCCO)C1CCC1.
What is the InChIKey of N-cyclobutyl-2-(2,4-difluorophenyl)-N-(3-hydroxypropyl)acetamide?
The InChIKey is UKOPLIUHFFKDLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F2NO2/c16-12-6-5-11(14(17)10-12)9-15(20)18(7-2-8-19)13-3-1-4-13/h5-6,10,13,19H,1-4,7-9H2.
What are the key properties of N-cyclobutyl-2-(2,4-difluorophenyl)-N-(3-hydroxypropyl)acetamide?
N-cyclobutyl-2-(2,4-difluorophenyl)-N-(3-hydroxypropyl)acetamide has a molecular weight of 283.32 g/mol, XLogP of 2.27, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclobutyl-2-(2,4-difluorophenyl)-N-(3-hydroxypropyl)acetamide is sourced from PubChem (CID 102866065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).