About N-cyclobutyl-3-(3,4-difluorophenyl)-N-(3-hydroxypropyl)propanamide
N-cyclobutyl-3-(3,4-difluorophenyl)-N-(3-hydroxypropyl)propanamide (PubChem CID 102866294) has the molecular formula C16H21F2NO2
and a molecular weight of 297.34 g/mol. Its IUPAC name is N-cyclobutyl-3-(3,4-difluorophenyl)-N-(3-hydroxypropyl)propanamide.
Molecular Properties
| Compound Name | N-cyclobutyl-3-(3,4-difluorophenyl)-N-(3-hydroxypropyl)propanamide |
| PubChem CID | 102866294 |
| Molecular Formula | C16H21F2NO2 |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-cyclobutyl-3-(3,4-difluorophenyl)-N-(3-hydroxypropyl)propanamide |
| SMILES | O=C(CCc1ccc(F)c(F)c1)N(CCCO)C1CCC1 |
| InChI | InChI=1S/C16H21F2NO2/c17-14-7-5-12(11-15(14)18)6-8-16(21)19(9-2-10-20)13-3-1-4-13/h5,7,11,13,20H,1-4,6,8-10H2 |
| InChIKey | OUCHVKPRKFHAOJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclobutyl-3-(3,4-difluorophenyl)-N-(3-hydroxypropyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclobutyl-3-(3,4-difluorophenyl)-N-(3-hydroxypropyl)propanamide?
The IUPAC name of N-cyclobutyl-3-(3,4-difluorophenyl)-N-(3-hydroxypropyl)propanamide (CID 102866294) is N-cyclobutyl-3-(3,4-difluorophenyl)-N-(3-hydroxypropyl)propanamide.
What is the SMILES notation for N-cyclobutyl-3-(3,4-difluorophenyl)-N-(3-hydroxypropyl)propanamide?
The canonical SMILES for N-cyclobutyl-3-(3,4-difluorophenyl)-N-(3-hydroxypropyl)propanamide is O=C(CCc1ccc(F)c(F)c1)N(CCCO)C1CCC1.
What is the InChIKey of N-cyclobutyl-3-(3,4-difluorophenyl)-N-(3-hydroxypropyl)propanamide?
The InChIKey is OUCHVKPRKFHAOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21F2NO2/c17-14-7-5-12(11-15(14)18)6-8-16(21)19(9-2-10-20)13-3-1-4-13/h5,7,11,13,20H,1-4,6,8-10H2.
What are the key properties of N-cyclobutyl-3-(3,4-difluorophenyl)-N-(3-hydroxypropyl)propanamide?
N-cyclobutyl-3-(3,4-difluorophenyl)-N-(3-hydroxypropyl)propanamide has a molecular weight of 297.34 g/mol, XLogP of 2.66, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclobutyl-3-(3,4-difluorophenyl)-N-(3-hydroxypropyl)propanamide is sourced from PubChem (CID 102866294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).