C16H16ClFO2 — CID 102867481
2-(3-chloro-2-fluorophenyl)-1-(3-methoxy-4-methylphenyl)ethanol (PubChem CID 102867481) has the molecular formula C16H16ClFO2 and a molecular weight of 294.75 g/mol. Its IUPAC name is 2-(3-chloro-2-fluorophenyl)-1-(3-methoxy-4-methylphenyl)ethanol.
| Compound Name | 2-(3-chloro-2-fluorophenyl)-1-(3-methoxy-4-methylphenyl)ethanol |
|---|---|
| PubChem CID | 102867481 |
| Molecular Formula | C16H16ClFO2 |
| Molecular Weight | 294.75 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 2-(3-chloro-2-fluorophenyl)-1-(3-methoxy-4-methylphenyl)ethanol |
| SMILES | COc1cc(C(O)Cc2cccc(Cl)c2F)ccc1C |
| InChI | InChI=1S/C16H16ClFO2/c1-10-6-7-11(9-15(10)20-2)14(19)8-12-4-3-5-13(17)16(12)18/h3-7,9,14,19H,8H2,1-2H3 |
| InChIKey | WGLPMBASAAVKJN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.75 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |