C15H20ClFO — CID 102867504
2-(3-chloro-2-fluorophenyl)-1-(1-ethylcyclopentyl)ethanol (PubChem CID 102867504) has the molecular formula C15H20ClFO and a molecular weight of 270.77 g/mol. Its IUPAC name is 2-(3-chloro-2-fluorophenyl)-1-(1-ethylcyclopentyl)ethanol.
| Compound Name | 2-(3-chloro-2-fluorophenyl)-1-(1-ethylcyclopentyl)ethanol |
|---|---|
| PubChem CID | 102867504 |
| Molecular Formula | C15H20ClFO |
| Molecular Weight | 270.77 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-(3-chloro-2-fluorophenyl)-1-(1-ethylcyclopentyl)ethanol |
| SMILES | CCC1(C(O)Cc2cccc(Cl)c2F)CCCC1 |
| InChI | InChI=1S/C15H20ClFO/c1-2-15(8-3-4-9-15)13(18)10-11-6-5-7-12(16)14(11)17/h5-7,13,18H,2-4,8-10H2,1H3 |
| InChIKey | PZPDZAZRJKGHCG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.77 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |