C13H14ClFN2OS — CID 102867582
2-(3-chloro-2-fluorophenyl)-1-(4-propylthiadiazol-5-yl)ethanol (PubChem CID 102867582) has the molecular formula C13H14ClFN2OS and a molecular weight of 300.79 g/mol. Its IUPAC name is 2-(3-chloro-2-fluorophenyl)-1-(4-propylthiadiazol-5-yl)ethanol.
| Compound Name | 2-(3-chloro-2-fluorophenyl)-1-(4-propylthiadiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 102867582 |
| Molecular Formula | C13H14ClFN2OS |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-(3-chloro-2-fluorophenyl)-1-(4-propylthiadiazol-5-yl)ethanol |
| SMILES | CCCc1nnsc1C(O)Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C13H14ClFN2OS/c1-2-4-10-13(19-17-16-10)11(18)7-8-5-3-6-9(14)12(8)15/h3,5-6,11,18H,2,4,7H2,1H3 |
| InChIKey | JRGHAFIWHIJCLY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |