C6H10F2N2 — CID 102868148
3-(1,1-difluoropropan-2-ylamino)propanenitrile (PubChem CID 102868148) has the molecular formula C6H10F2N2 and a molecular weight of 148.16 g/mol. Its IUPAC name is 3-(1,1-difluoropropan-2-ylamino)propanenitrile.
| Compound Name | 3-(1,1-difluoropropan-2-ylamino)propanenitrile |
|---|---|
| PubChem CID | 102868148 |
| Molecular Formula | C6H10F2N2 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | 3-(1,1-difluoropropan-2-ylamino)propanenitrile |
| SMILES | CC(NCCC#N)C(F)F |
| InChI | InChI=1S/C6H10F2N2/c1-5(6(7)8)10-4-2-3-9/h5-6,10H,2,4H2,1H3 |
| InChIKey | YIWWTLWKGFPUPO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|