C14H20F2N2 — CID 102868409
N-(1,1-difluoropropan-2-yl)-4-(pyrrolidin-1-ylmethyl)aniline (PubChem CID 102868409) has the molecular formula C14H20F2N2 and a molecular weight of 254.32 g/mol. Its IUPAC name is N-(1,1-difluoropropan-2-yl)-4-(pyrrolidin-1-ylmethyl)aniline.
| Compound Name | N-(1,1-difluoropropan-2-yl)-4-(pyrrolidin-1-ylmethyl)aniline |
|---|---|
| PubChem CID | 102868409 |
| Molecular Formula | C14H20F2N2 |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | N-(1,1-difluoropropan-2-yl)-4-(pyrrolidin-1-ylmethyl)aniline |
| SMILES | CC(Nc1ccc(CN2CCCC2)cc1)C(F)F |
| InChI | InChI=1S/C14H20F2N2/c1-11(14(15)16)17-13-6-4-12(5-7-13)10-18-8-2-3-9-18/h4-7,11,14,17H,2-3,8-10H2,1H3 |
| InChIKey | XOWHDZOLXJZQPH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |