C10H11F2N5 — CID 102868555
N-(1,1-difluoropropan-2-yl)-2-(tetrazol-1-yl)aniline (PubChem CID 102868555) has the molecular formula C10H11F2N5 and a molecular weight of 239.23 g/mol. Its IUPAC name is N-(1,1-difluoropropan-2-yl)-2-(tetrazol-1-yl)aniline.
| Compound Name | N-(1,1-difluoropropan-2-yl)-2-(tetrazol-1-yl)aniline |
|---|---|
| PubChem CID | 102868555 |
| Molecular Formula | C10H11F2N5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | N-(1,1-difluoropropan-2-yl)-2-(tetrazol-1-yl)aniline |
| SMILES | CC(Nc1ccccc1-n1cnnn1)C(F)F |
| InChI | InChI=1S/C10H11F2N5/c1-7(10(11)12)14-8-4-2-3-5-9(8)17-6-13-15-16-17/h2-7,10,14H,1H3 |
| InChIKey | GMHIOYHGKYNNKR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |