C20H36NO2P — CID 10286857
methyl-[3-[(4-nonylphenyl)methylamino]propyl]phosphinic acid (PubChem CID 10286857) has the molecular formula C20H36NO2P and a molecular weight of 353.49 g/mol. Its IUPAC name is methyl-[3-[(4-nonylphenyl)methylamino]propyl]phosphinic acid.
| Compound Name | methyl-[3-[(4-nonylphenyl)methylamino]propyl]phosphinic acid |
|---|---|
| PubChem CID | 10286857 |
| Molecular Formula | C20H36NO2P |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | methyl-[3-[(4-nonylphenyl)methylamino]propyl]phosphinic acid |
| SMILES | CCCCCCCCCc1ccc(CNCCCP(C)(=O)O)cc1 |
| InChI | InChI=1S/C20H36NO2P/c1-3-4-5-6-7-8-9-11-19-12-14-20(15-13-19)18-21-16-10-17-24(2,22)23/h12-15,21H,3-11,16-18H2,1-2H3,(H,22,23) |
| InChIKey | GYRSLHWASFQOPP-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|