C11H12F2N2 — CID 102868708
2-[4-(1,1-difluoropropan-2-ylamino)phenyl]acetonitrile (PubChem CID 102868708) has the molecular formula C11H12F2N2 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-[4-(1,1-difluoropropan-2-ylamino)phenyl]acetonitrile.
| Compound Name | 2-[4-(1,1-difluoropropan-2-ylamino)phenyl]acetonitrile |
|---|---|
| PubChem CID | 102868708 |
| Molecular Formula | C11H12F2N2 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 2-[4-(1,1-difluoropropan-2-ylamino)phenyl]acetonitrile |
| SMILES | CC(Nc1ccc(CC#N)cc1)C(F)F |
| InChI | InChI=1S/C11H12F2N2/c1-8(11(12)13)15-10-4-2-9(3-5-10)6-7-14/h2-5,8,11,15H,6H2,1H3 |
| InChIKey | CDYXRPQRQGNLNX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |