About N-(1,1-difluoropropan-2-yl)-2-imidazol-1-ylcyclopentan-1-amine
N-(1,1-difluoropropan-2-yl)-2-imidazol-1-ylcyclopentan-1-amine (PubChem CID 102868865) has the molecular formula C11H17F2N3
and a molecular weight of 229.27 g/mol. Its IUPAC name is N-(1,1-difluoropropan-2-yl)-2-imidazol-1-ylcyclopentan-1-amine.
Molecular Properties
| Compound Name | N-(1,1-difluoropropan-2-yl)-2-imidazol-1-ylcyclopentan-1-amine |
| PubChem CID | 102868865 |
| Molecular Formula | C11H17F2N3 |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | N-(1,1-difluoropropan-2-yl)-2-imidazol-1-ylcyclopentan-1-amine |
| SMILES | CC(NC1CCCC1n1ccnc1)C(F)F |
| InChI | InChI=1S/C11H17F2N3/c1-8(11(12)13)15-9-3-2-4-10(9)16-6-5-14-7-16/h5-11,15H,2-4H2,1H3 |
| InChIKey | DLULOISXIRYAEY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1,1-difluoropropan-2-yl)-2-imidazol-1-ylcyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,1-difluoropropan-2-yl)-2-imidazol-1-ylcyclopentan-1-amine?
The IUPAC name of N-(1,1-difluoropropan-2-yl)-2-imidazol-1-ylcyclopentan-1-amine (CID 102868865) is N-(1,1-difluoropropan-2-yl)-2-imidazol-1-ylcyclopentan-1-amine.
What is the SMILES notation for N-(1,1-difluoropropan-2-yl)-2-imidazol-1-ylcyclopentan-1-amine?
The canonical SMILES for N-(1,1-difluoropropan-2-yl)-2-imidazol-1-ylcyclopentan-1-amine is CC(NC1CCCC1n1ccnc1)C(F)F.
What is the InChIKey of N-(1,1-difluoropropan-2-yl)-2-imidazol-1-ylcyclopentan-1-amine?
The InChIKey is DLULOISXIRYAEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F2N3/c1-8(11(12)13)15-9-3-2-4-10(9)16-6-5-14-7-16/h5-11,15H,2-4H2,1H3.
What are the key properties of N-(1,1-difluoropropan-2-yl)-2-imidazol-1-ylcyclopentan-1-amine?
N-(1,1-difluoropropan-2-yl)-2-imidazol-1-ylcyclopentan-1-amine has a molecular weight of 229.27 g/mol, XLogP of 2.22, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,1-difluoropropan-2-yl)-2-imidazol-1-ylcyclopentan-1-amine is sourced from PubChem (CID 102868865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).