C11H16F2N2O — CID 102869142
5-(1,1-difluoropropan-2-ylamino)-1-propylpyridin-2-one (PubChem CID 102869142) has the molecular formula C11H16F2N2O and a molecular weight of 230.26 g/mol. Its IUPAC name is 5-(1,1-difluoropropan-2-ylamino)-1-propylpyridin-2-one.
| Compound Name | 5-(1,1-difluoropropan-2-ylamino)-1-propylpyridin-2-one |
|---|---|
| PubChem CID | 102869142 |
| Molecular Formula | C11H16F2N2O |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 5-(1,1-difluoropropan-2-ylamino)-1-propylpyridin-2-one |
| SMILES | CCCn1cc(NC(C)C(F)F)ccc1=O |
| InChI | InChI=1S/C11H16F2N2O/c1-3-6-15-7-9(4-5-10(15)16)14-8(2)11(12)13/h4-5,7-8,11,14H,3,6H2,1-2H3 |
| InChIKey | BCGZSVFCYJRRLF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |