C13H20F2N2O — CID 102869200
2-[4-(1,1-difluoropropan-2-ylamino)-N-ethylanilino]ethanol (PubChem CID 102869200) has the molecular formula C13H20F2N2O and a molecular weight of 258.31 g/mol. Its IUPAC name is 2-[4-(1,1-difluoropropan-2-ylamino)-N-ethylanilino]ethanol.
| Compound Name | 2-[4-(1,1-difluoropropan-2-ylamino)-N-ethylanilino]ethanol |
|---|---|
| PubChem CID | 102869200 |
| Molecular Formula | C13H20F2N2O |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 2-[4-(1,1-difluoropropan-2-ylamino)-N-ethylanilino]ethanol |
| SMILES | CCN(CCO)c1ccc(NC(C)C(F)F)cc1 |
| InChI | InChI=1S/C13H20F2N2O/c1-3-17(8-9-18)12-6-4-11(5-7-12)16-10(2)13(14)15/h4-7,10,13,16,18H,3,8-9H2,1-2H3 |
| InChIKey | WQWUUHJFXDHZSG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|