C12H24F2N2 — CID 102869208
1-tert-butyl-N-(1,1-difluoropropan-2-yl)piperidin-4-amine (PubChem CID 102869208) has the molecular formula C12H24F2N2 and a molecular weight of 234.33 g/mol. Its IUPAC name is 1-tert-butyl-N-(1,1-difluoropropan-2-yl)piperidin-4-amine.
| Compound Name | 1-tert-butyl-N-(1,1-difluoropropan-2-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 102869208 |
| Molecular Formula | C12H24F2N2 |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.19 |
| IUPAC Name | 1-tert-butyl-N-(1,1-difluoropropan-2-yl)piperidin-4-amine |
| SMILES | CC(NC1CCN(C(C)(C)C)CC1)C(F)F |
| InChI | InChI=1S/C12H24F2N2/c1-9(11(13)14)15-10-5-7-16(8-6-10)12(2,3)4/h9-11,15H,5-8H2,1-4H3 |
| InChIKey | WZJZNWLKCSEHMF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |