C11H15F2NO — CID 102869382
1,1-difluoro-N-(2-phenoxyethyl)propan-2-amine (PubChem CID 102869382) has the molecular formula C11H15F2NO and a molecular weight of 215.24 g/mol. Its IUPAC name is 1,1-difluoro-N-(2-phenoxyethyl)propan-2-amine.
| Compound Name | 1,1-difluoro-N-(2-phenoxyethyl)propan-2-amine |
|---|---|
| PubChem CID | 102869382 |
| Molecular Formula | C11H15F2NO |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 1,1-difluoro-N-(2-phenoxyethyl)propan-2-amine |
| SMILES | CC(NCCOc1ccccc1)C(F)F |
| InChI | InChI=1S/C11H15F2NO/c1-9(11(12)13)14-7-8-15-10-5-3-2-4-6-10/h2-6,9,11,14H,7-8H2,1H3 |
| InChIKey | KEHNHGBYHQGNGG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|