C12H17F2NO — CID 102869475
N-(1,1-difluoropropan-2-yl)-4-propoxyaniline (PubChem CID 102869475) has the molecular formula C12H17F2NO and a molecular weight of 229.27 g/mol. Its IUPAC name is N-(1,1-difluoropropan-2-yl)-4-propoxyaniline.
| Compound Name | N-(1,1-difluoropropan-2-yl)-4-propoxyaniline |
|---|---|
| PubChem CID | 102869475 |
| Molecular Formula | C12H17F2NO |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | N-(1,1-difluoropropan-2-yl)-4-propoxyaniline |
| SMILES | CCCOc1ccc(NC(C)C(F)F)cc1 |
| InChI | InChI=1S/C12H17F2NO/c1-3-8-16-11-6-4-10(5-7-11)15-9(2)12(13)14/h4-7,9,12,15H,3,8H2,1-2H3 |
| InChIKey | ZRKPMZZBVJLRHD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|