About N-[1-(1,1-difluoropropan-2-ylamino)-2-methylpropan-2-yl]methanesulfonamide
N-[1-(1,1-difluoropropan-2-ylamino)-2-methylpropan-2-yl]methanesulfonamide (PubChem CID 102869586) has the molecular formula C8H18F2N2O2S
and a molecular weight of 244.31 g/mol. Its IUPAC name is N-[1-(1,1-difluoropropan-2-ylamino)-2-methylpropan-2-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[1-(1,1-difluoropropan-2-ylamino)-2-methylpropan-2-yl]methanesulfonamide |
| PubChem CID | 102869586 |
| Molecular Formula | C8H18F2N2O2S |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | N-[1-(1,1-difluoropropan-2-ylamino)-2-methylpropan-2-yl]methanesulfonamide |
| SMILES | CC(NCC(C)(C)NS(C)(=O)=O)C(F)F |
| InChI | InChI=1S/C8H18F2N2O2S/c1-6(7(9)10)11-5-8(2,3)12-15(4,13)14/h6-7,11-12H,5H2,1-4H3 |
| InChIKey | OMQOWANQSHMWIH-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-(1,1-difluoropropan-2-ylamino)-2-methylpropan-2-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(1,1-difluoropropan-2-ylamino)-2-methylpropan-2-yl]methanesulfonamide?
The IUPAC name of N-[1-(1,1-difluoropropan-2-ylamino)-2-methylpropan-2-yl]methanesulfonamide (CID 102869586) is N-[1-(1,1-difluoropropan-2-ylamino)-2-methylpropan-2-yl]methanesulfonamide.
What is the SMILES notation for N-[1-(1,1-difluoropropan-2-ylamino)-2-methylpropan-2-yl]methanesulfonamide?
The canonical SMILES for N-[1-(1,1-difluoropropan-2-ylamino)-2-methylpropan-2-yl]methanesulfonamide is CC(NCC(C)(C)NS(C)(=O)=O)C(F)F.
What is the InChIKey of N-[1-(1,1-difluoropropan-2-ylamino)-2-methylpropan-2-yl]methanesulfonamide?
The InChIKey is OMQOWANQSHMWIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18F2N2O2S/c1-6(7(9)10)11-5-8(2,3)12-15(4,13)14/h6-7,11-12H,5H2,1-4H3.
What are the key properties of N-[1-(1,1-difluoropropan-2-ylamino)-2-methylpropan-2-yl]methanesulfonamide?
N-[1-(1,1-difluoropropan-2-ylamino)-2-methylpropan-2-yl]methanesulfonamide has a molecular weight of 244.31 g/mol, XLogP of 0.56, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(1,1-difluoropropan-2-ylamino)-2-methylpropan-2-yl]methanesulfonamide is sourced from PubChem (CID 102869586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).