About N-(1,1-difluoropropan-2-yl)-1,1-dimethoxypropan-2-amine
N-(1,1-difluoropropan-2-yl)-1,1-dimethoxypropan-2-amine (PubChem CID 102869609) has the molecular formula C8H17F2NO2
and a molecular weight of 197.22 g/mol. Its IUPAC name is N-(1,1-difluoropropan-2-yl)-1,1-dimethoxypropan-2-amine.
Molecular Properties
| Compound Name | N-(1,1-difluoropropan-2-yl)-1,1-dimethoxypropan-2-amine |
| PubChem CID | 102869609 |
| Molecular Formula | C8H17F2NO2 |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | N-(1,1-difluoropropan-2-yl)-1,1-dimethoxypropan-2-amine |
| SMILES | COC(OC)C(C)NC(C)C(F)F |
| InChI | InChI=1S/C8H17F2NO2/c1-5(7(9)10)11-6(2)8(12-3)13-4/h5-8,11H,1-4H3 |
| InChIKey | HKEZIGSUXRNIPW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(1,1-difluoropropan-2-yl)-1,1-dimethoxypropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,1-difluoropropan-2-yl)-1,1-dimethoxypropan-2-amine?
The IUPAC name of N-(1,1-difluoropropan-2-yl)-1,1-dimethoxypropan-2-amine (CID 102869609) is N-(1,1-difluoropropan-2-yl)-1,1-dimethoxypropan-2-amine.
What is the SMILES notation for N-(1,1-difluoropropan-2-yl)-1,1-dimethoxypropan-2-amine?
The canonical SMILES for N-(1,1-difluoropropan-2-yl)-1,1-dimethoxypropan-2-amine is COC(OC)C(C)NC(C)C(F)F.
What is the InChIKey of N-(1,1-difluoropropan-2-yl)-1,1-dimethoxypropan-2-amine?
The InChIKey is HKEZIGSUXRNIPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17F2NO2/c1-5(7(9)10)11-6(2)8(12-3)13-4/h5-8,11H,1-4H3.
What are the key properties of N-(1,1-difluoropropan-2-yl)-1,1-dimethoxypropan-2-amine?
N-(1,1-difluoropropan-2-yl)-1,1-dimethoxypropan-2-amine has a molecular weight of 197.22 g/mol, XLogP of 1.24, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,1-difluoropropan-2-yl)-1,1-dimethoxypropan-2-amine is sourced from PubChem (CID 102869609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).