About 4-N-(3-fluoro-4-isoquinolin-5-yloxyphenyl)pyrimidine-2,4,6-triamine
4-N-(3-fluoro-4-isoquinolin-5-yloxyphenyl)pyrimidine-2,4,6-triamine (PubChem CID 10286969) has the molecular formula C19H15FN6O
and a molecular weight of 362.37 g/mol. Its IUPAC name is 4-N-(3-fluoro-4-isoquinolin-5-yloxyphenyl)pyrimidine-2,4,6-triamine.
Molecular Properties
| Compound Name | 4-N-(3-fluoro-4-isoquinolin-5-yloxyphenyl)pyrimidine-2,4,6-triamine |
| PubChem CID | 10286969 |
| Molecular Formula | C19H15FN6O |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 4-N-(3-fluoro-4-isoquinolin-5-yloxyphenyl)pyrimidine-2,4,6-triamine |
| SMILES | Nc1cc(Nc2ccc(Oc3cccc4cnccc34)c(F)c2)nc(N)n1 |
| InChI | InChI=1S/C19H15FN6O/c20-14-8-12(24-18-9-17(21)25-19(22)26-18)4-5-16(14)27-15-3-1-2-11-10-23-7-6-13(11)15/h1-10H,(H5,21,22,24,25,26) |
| InChIKey | UBSJTMIKLCURGP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-N-(3-fluoro-4-isoquinolin-5-yloxyphenyl)pyrimidine-2,4,6-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(3-fluoro-4-isoquinolin-5-yloxyphenyl)pyrimidine-2,4,6-triamine?
The IUPAC name of 4-N-(3-fluoro-4-isoquinolin-5-yloxyphenyl)pyrimidine-2,4,6-triamine (CID 10286969) is 4-N-(3-fluoro-4-isoquinolin-5-yloxyphenyl)pyrimidine-2,4,6-triamine.
What is the SMILES notation for 4-N-(3-fluoro-4-isoquinolin-5-yloxyphenyl)pyrimidine-2,4,6-triamine?
The canonical SMILES for 4-N-(3-fluoro-4-isoquinolin-5-yloxyphenyl)pyrimidine-2,4,6-triamine is Nc1cc(Nc2ccc(Oc3cccc4cnccc34)c(F)c2)nc(N)n1.
What is the InChIKey of 4-N-(3-fluoro-4-isoquinolin-5-yloxyphenyl)pyrimidine-2,4,6-triamine?
The InChIKey is UBSJTMIKLCURGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15FN6O/c20-14-8-12(24-18-9-17(21)25-19(22)26-18)4-5-16(14)27-15-3-1-2-11-10-23-7-6-13(11)15/h1-10H,(H5,21,22,24,25,26).
What are the key properties of 4-N-(3-fluoro-4-isoquinolin-5-yloxyphenyl)pyrimidine-2,4,6-triamine?
4-N-(3-fluoro-4-isoquinolin-5-yloxyphenyl)pyrimidine-2,4,6-triamine has a molecular weight of 362.37 g/mol, XLogP of 3.86, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(3-fluoro-4-isoquinolin-5-yloxyphenyl)pyrimidine-2,4,6-triamine is sourced from PubChem (CID 10286969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).