About [2-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]methanol
[2-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]methanol (PubChem CID 102869691) has the molecular formula C11H21F2NO
and a molecular weight of 221.29 g/mol. Its IUPAC name is [2-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]methanol.
Molecular Properties
| Compound Name | [2-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]methanol |
| PubChem CID | 102869691 |
| Molecular Formula | C11H21F2NO |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | [2-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]methanol |
| SMILES | CC(NCC1CCCCC1CO)C(F)F |
| InChI | InChI=1S/C11H21F2NO/c1-8(11(12)13)14-6-9-4-2-3-5-10(9)7-15/h8-11,14-15H,2-7H2,1H3 |
| InChIKey | WXRNVUHKIODWQT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]methanol?
The IUPAC name of [2-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]methanol (CID 102869691) is [2-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]methanol.
What is the SMILES notation for [2-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]methanol?
The canonical SMILES for [2-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]methanol is CC(NCC1CCCCC1CO)C(F)F.
What is the InChIKey of [2-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]methanol?
The InChIKey is WXRNVUHKIODWQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F2NO/c1-8(11(12)13)14-6-9-4-2-3-5-10(9)7-15/h8-11,14-15H,2-7H2,1H3.
What are the key properties of [2-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]methanol?
[2-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]methanol has a molecular weight of 221.29 g/mol, XLogP of 2.03, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]methanol is sourced from PubChem (CID 102869691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).