About N-[(2R)-3-(2,5-dimethylpyrrolidin-1-yl)-2-hydroxypropyl]naphthalene-1-sulfonamide
N-[(2R)-3-(2,5-dimethylpyrrolidin-1-yl)-2-hydroxypropyl]naphthalene-1-sulfonamide (PubChem CID 10286974) has the molecular formula C19H26N2O3S
and a molecular weight of 362.50 g/mol. Its IUPAC name is N-[(2R)-3-(2,5-dimethylpyrrolidin-1-yl)-2-hydroxypropyl]naphthalene-1-sulfonamide.
Molecular Properties
| Compound Name | N-[(2R)-3-(2,5-dimethylpyrrolidin-1-yl)-2-hydroxypropyl]naphthalene-1-sulfonamide |
| PubChem CID | 10286974 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | N-[(2R)-3-(2,5-dimethylpyrrolidin-1-yl)-2-hydroxypropyl]naphthalene-1-sulfonamide |
| SMILES | CC1CCC(C)N1C[C@@H](O)CNS(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H26N2O3S/c1-14-10-11-15(2)21(14)13-17(22)12-20-25(23,24)19-9-5-7-16-6-3-4-8-18(16)19/h3-9,14-15,17,20,22H,10-13H2,1-2H3/t14?,15?,17-/m0/s1 |
| InChIKey | GBQZPHGKWXWKET-DQPZFDDXSA-N |
| XLogP | 2.35 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(2R)-3-(2,5-dimethylpyrrolidin-1-yl)-2-hydroxypropyl]naphthalene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-3-(2,5-dimethylpyrrolidin-1-yl)-2-hydroxypropyl]naphthalene-1-sulfonamide?
The IUPAC name of N-[(2R)-3-(2,5-dimethylpyrrolidin-1-yl)-2-hydroxypropyl]naphthalene-1-sulfonamide (CID 10286974) is N-[(2R)-3-(2,5-dimethylpyrrolidin-1-yl)-2-hydroxypropyl]naphthalene-1-sulfonamide.
What is the SMILES notation for N-[(2R)-3-(2,5-dimethylpyrrolidin-1-yl)-2-hydroxypropyl]naphthalene-1-sulfonamide?
The canonical SMILES for N-[(2R)-3-(2,5-dimethylpyrrolidin-1-yl)-2-hydroxypropyl]naphthalene-1-sulfonamide is CC1CCC(C)N1C[C@@H](O)CNS(=O)(=O)c1cccc2ccccc12.
What is the InChIKey of N-[(2R)-3-(2,5-dimethylpyrrolidin-1-yl)-2-hydroxypropyl]naphthalene-1-sulfonamide?
The InChIKey is GBQZPHGKWXWKET-DQPZFDDXSA-N. The full InChI is InChI=1S/C19H26N2O3S/c1-14-10-11-15(2)21(14)13-17(22)12-20-25(23,24)19-9-5-7-16-6-3-4-8-18(16)19/h3-9,14-15,17,20,22H,10-13H2,1-2H3/t14?,15?,17-/m0/s1.
What are the key properties of N-[(2R)-3-(2,5-dimethylpyrrolidin-1-yl)-2-hydroxypropyl]naphthalene-1-sulfonamide?
N-[(2R)-3-(2,5-dimethylpyrrolidin-1-yl)-2-hydroxypropyl]naphthalene-1-sulfonamide has a molecular weight of 362.50 g/mol, XLogP of 2.35, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-3-(2,5-dimethylpyrrolidin-1-yl)-2-hydroxypropyl]naphthalene-1-sulfonamide is sourced from PubChem (CID 10286974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).